Math · Advanced Functions · Grade 9-12 · 5 min read

Sum and Difference Identities

⚡ In one breath

Sum and difference identities expand a trig function of A±BA\pm B into products of the two angles' sines and cosines.

📐 The formula

sin(A±B)=sinAcosB±cosAsinB\sin(A \pm B) = \sin A\cos B \pm \cos A\sin B
cos(A±B)=cosAcosBsinAsinB\cos(A \pm B) = \cos A\cos B \mp \sin A\sin B
tan(A±B)=tanA±tanB1tanAtanB\tan(A \pm B) = \frac{\tan A \pm \tan B}{1 \mp \tan A\tan B}

Orient

The one-line idea, why it matters, and the intuition.

Section 1

Quick Answer

Sum and difference identities expand a trig function of A±BA\pm B into products of the two angles' sines and cosines. Use them to evaluate non-standard angles (like 75°=45°+30°75°=45°+30°) or to simplify expressions hiding this product pattern. The cue is a trig function whose argument is itself a sum or difference of angles. Before calculating, ask: Is the argument of the trig function a sum or difference of two angles I want to break apart?

Section 2

Why This Matters

They unlock exact values for angles outside the special set and are the launchpad for double-angle and product-to-sum work. The fatal error — assuming sin(A+B)=sinA+sinB\sin(A+B)=\sin A+\sin B — wrecks all of trig, since trig functions are not linear. Recognizing it by "Is the argument of the trig function a sum or difference of two angles I want to break apart?" — rather than by familiar numbers — is what lets a student tell it apart from double-angle identities and pythagorean identities and distributing the function (wrong) in a mixed problem set.

Section 3

Intuitive Explanation

Two rotations stacked: turn by AA, then by BB; the final point's coordinates mix both angles' sines and cosines rather than just adding them. This is the clean version of the idea because the visible structure matches the concept before any formula or procedure is chosen.

Distributing the function over the sum: sin(A+B)sinA+sinB\sin(A+B)\ne\sin A+\sin B — the expansion mixes sines and cosines as cross products. That contrast matters because many wrong answers come from recognizing a surface feature, such as a familiar number or word, instead of the actual task.

A useful way to slow down is to name the signal words and then test them. Words like **sin(A+B)\sin(A+B)**, **exact value of 75°75° or 15°15°**, **A±BA\pm B inside the function**, **combine two angles**, **cos(AB)\cos(A-B)** are helpful clues, but they are not enough by themselves. They must point to the same structure as the mental model: sin(A±B)\sin(A\pm B) and cos(A±B)\cos(A\pm B) expand into cross products of the separate angles' sines and cosines.

The recognition test is simple: Is the argument of the trig function a sum or difference of two angles I want to break apart? If yes, sum and difference identities is probably the right tool; if not, compare with Double-angle identities or Pythagorean identities or Distributing the function (wrong) before calculating.

Core idea

sin(A±B)\sin(A\pm B) and cos(A±B)\cos(A\pm B) expand into cross products of the separate angles' sines and cosines.

Recognize

The cues that signal this concept and how to distinguish it from look-alikes.

Section 4

When to Use

Use Sum and Difference Identities when the angle inside a trig function is written as a sum or difference of two angles you know. Strong signals include **sin(A+B)\sin(A+B)**, **exact value of 75°75° or 15°15°**, **A±BA\pm B inside the function**, **combine two angles**, **cos(AB)\cos(A-B)**. The safest workflow is to read the final question first, identify what kind of answer it wants, and then test the structure. Do not use sum and difference identities just because familiar numbers appear; first decide whether the situation answers "Is the argument of the trig function a sum or difference of two angles I want to break apart?" with yes.

✨ Pro tip

Ask: Is the argument of the trig function a sum or difference of two angles I want to break apart?

Section 5

How to Recognize It

Before using Sum and Difference Identities, check the structure of the problem, not just the vocabulary. These questions force the same recognition move from several angles: the task, the signal words, the nearest confusion, and the thing that would make the concept fail.

  1. Is the argument of the trig function a sum or difference of two angles I want to break apart?

    If yes, the problem matches sum and difference identities. If no, pause before applying the procedure, because the same numbers may belong to a different idea.

  2. Which words signal the structure?

    Look for sin(A+B)\sin(A+B), exact value of 75°75° or 15°15°, A±BA\pm B inside the function, combine two angles. These words are useful only after the situation matches them; a keyword without structure is not proof.

  3. What is the nearest confusion?

    Double-angle identities is the common trap here: The special case where both angles are equal, A=BA=B. Compare the desired final answer before choosing a method.

  4. What answer form should I expect?

    The answer should fit this mental model: sin(A±B)\sin(A\pm B) and cos(A±B)\cos(A\pm B) expand into cross products of the separate angles' sines and cosines. If the expected answer sounds more like double-angle identities, use the comparison table before solving.

  5. What would make this NOT Sum and Difference Identities?

    Distributing the function over the sum: sin(A+B)sinA+sinB\sin(A+B)\ne\sin A+\sin B — the expansion mixes sines and cosines as cross products. This tells you when to switch tools instead of forcing the concept.

Section 6

Sum and Difference Identities vs Common Confusions

The hard part is recognizing when the task is really about sum and difference identities instead of a nearby idea. Read the final answer the problem wants, then ask which row describes the structure before you start calculating.

Sum and Difference Identities

Meaning
Use this when the angle inside a trig function is written as a sum or difference of two angles you know. The deciding question is: Is the argument of the trig function a sum or difference of two angles I want to break apart?
Key test
Is the argument of the trig function a sum or difference of two angles I want to break apart?
Formula
sin(A±B)=sinAcosB±cosAsinB\sin(A \pm B) = \sin A\cos B \pm \cos A\sin B
cos(A±B)=cosAcosBsinAsinB\cos(A \pm B) = \cos A\cos B \mp \sin A\sin B
tan(A±B)=tanA±tanB1tanAtanB\tan(A \pm B) = \frac{\tan A \pm \tan B}{1 \mp \tan A\tan B}
Example
Find the exact value of cos75°\cos 75°.

Double-angle identities

Meaning
The special case where both angles are equal, A=BA=B.
Key test
Use when the angle is exactly twice another, like 2θ2\theta.
Formula
sin2θ=2sinθcosθ\sin 2\theta=2\sin\theta\cos\theta
Example
sin80°\sin 80° from 40°40°

Pythagorean identities

Meaning
Relate squares of one angle's trig values; no second angle involved.
Key test
Use when you have sin2\sin^2 and cos2\cos^2 of the same angle.
Formula
sin2θ+cos2θ=1\sin^2\theta+\cos^2\theta=1
Example
Simplify 1cos2θ1-\cos^2\theta

Distributing the function (wrong)

Meaning
The illegal move of splitting sin(A+B)\sin(A+B) into sinA+sinB\sin A+\sin B.
Key test
Never use — trig functions are not linear; this is always wrong.
Example
sin(30°+60°)sin30°+sin60°\sin(30°+60°)\ne\sin30°+\sin60°

Apply

Worked examples and the mistakes most students make.

Section 7

Formula & Notation

sin(A±B)=sinAcosB±cosAsinB\sin(A \pm B) = \sin A\cos B \pm \cos A\sin B
cos(A±B)=cosAcosBsinAsinB\cos(A \pm B) = \cos A\cos B \mp \sin A\sin B
tan(A±B)=tanA±tanB1tanAtanB\tan(A \pm B) = \frac{\tan A \pm \tan B}{1 \mp \tan A\tan B}
sin(A±B)=sinAcosB±cosAsinB\sin(A \pm B) = \sin A\cos B \pm \cos A\sin B; cos(A±B)=cosAcosBsinAsinB\cos(A \pm B) = \cos A\cos B \mp \sin A\sin B; tan(A±B)=tanA±tanB1tanAtanB\tan(A \pm B) = \frac{\tan A \pm \tan B}{1 \mp \tan A\tan B}

How to read it: Note the sign pattern: in the cosine formula, ±\pm becomes \mp (signs are opposite). In sine and tangent, signs match.

Section 8

Worked Examples

Example 1 — Exact value of cos 75°

Easy

Problem

Find the exact value of cos75°\cos 75°.

Solution

  1. 75°=45°+30°75°=45°+30°, a sum of two known angles.

    Name the structure before touching arithmetic — that is what makes the right method obvious.

  2. Ask the recognition question: Is the argument of the trig function a sum or difference of two angles I want to break apart?

    If the answer is yes, the concept applies; the cue, not a keyword, decides the method.

  3. Apply cos(A+B)=cosAcosBsinAsinB\cos(A+B)=\cos A\cos B-\sin A\sin B with A=45°,B=30°A=45°,B=30°.

    The rule is chosen only after the structure matches, so the steps mean something.

  4. 22322212=624\frac{\sqrt2}{2}\cdot\frac{\sqrt3}{2}-\frac{\sqrt2}{2}\cdot\frac{1}{2}=\frac{\sqrt6-\sqrt2}{4}.

    Keep units, shape, or answer form tied to the story so the work does not become symbol pushing.

  5. Check the answer against the original question.

    It should fit the mental model — trig of a sum is a mix, never a sum of trigs. If it does not, revisit the recognition step before changing the arithmetic.

Answer

624\frac{\sqrt6-\sqrt2}{4}

Takeaway: Splitting an angle into a known sum lets the identity build an exact value.

Example 2 — Both angles are equal

Standard

Problem

Find cos2θ\cos 2\theta given θ\theta — do you use the difference identity?

Solution

  1. Notice why this looks like the same concept.

    Nearby language or numbers can tempt you toward trig of a sum is a mix, never a sum of trigs.

  2. The two angles are identical, A=B=θA=B=\theta, not distinct.

    Spotting what actually changed is what separates this from the concept it resembles.

  3. Collapse the sum identity into the double-angle form instead of two separate angles.

    The nearby idea may share numbers but answers a different question, so it needs a different move.

  4. State the result in the language of the actual task.

    cos2θ=cos2θsin2θ\cos 2\theta=\cos^2\theta-\sin^2\theta. Name it for what the problem really asked, not the concept you first expected.

  5. Say the contrast in one sentence.

    Equal angles specialize the sum identity into the double-angle one.

Answer

cos2θ=cos2θsin2θ\cos 2\theta=\cos^2\theta-\sin^2\theta

Takeaway: Equal angles specialize the sum identity into the double-angle one.

Example 3 — Spot the trap: Trig of a sum is a mix, never a sum of trigs

Application

Problem

A student starts with this idea: "Splitting cos(A+B)\cos(A+B) as cosA+cosB\cos A+\cos B" What should they check before accepting that reasoning?

Solution

  1. Pause before the first move.

    The first move is a decision, not a calculation — does the situation really match trig of a sum is a mix, never a sum of trigs.

  2. Run the recognition test: Is the argument of the trig function a sum or difference of two angles I want to break apart?

    This is the single check that the trap skips.

  3. it expands to cosAcosBsinAsinB\cos A\cos B-\sin A\sin B, a product mix.

    Stating the safer rule turns the mistake into a checkable step instead of a vague "be careful."

  4. Compare with the nearest confusion, Double-angle identities.

    The special case where both angles are equal, A=BA=B.

  5. State the corrected decision and reuse it.

    Using the concept only when the structure matches leaves a process the student can repeat on a new problem.

Answer

it expands to cosAcosBsinAsinB\cos A\cos B-\sin A\sin B, a product mix.

Takeaway: The recognition step prevents the common trap: Splitting cos(A+B)\cos(A+B) as cosA+cosB\cos A+\cos B

Section 9

Common Mistakes

Common slip-up

Splitting cos(A+B)\cos(A+B) as cosA+cosB\cos A+\cos B

The right idea

it expands to cosAcosBsinAsinB\cos A\cos B-\sin A\sin B, a product mix.

Common slip-up

Getting the cosine sign wrong

The right idea

in cosine the inside ++ becomes a - between the products (\mp flips).

Common slip-up

Using matching signs for cosine

The right idea

sine and tangent keep the sign, cosine reverses it.

Practice

Try it, then see where this concept fits in the path.

Section 10

Mini Practice

Try these on your own. Tap Reveal when you want to check.

  1. What clue tells you this is a Sum and Difference Identities situation: Find the exact value of cos75°\cos 75°.

    Hint: Is the argument of the trig function a sum or difference of two angles I want to break apart?

  2. Find the exact value of cos75°\cos 75°.

    Hint: Apply cos(A+B)=cosAcosBsinAsinB\cos(A+B)=\cos A\cos B-\sin A\sin B with A=45°,B=30°A=45°,B=30°.

  3. Why is this a contrast case instead of Sum and Difference Identities: Find cos2θ\cos 2\theta given θ\theta — do you use the difference identity?

    Hint: The two angles are identical, A=B=θA=B=\theta, not distinct.

  4. Fix this thinking: Splitting cos(A+B)\cos(A+B) as cosA+cosB\cos A+\cos B

    Hint: Name the recognition cue before choosing a rule.

  5. Which is the better fit here: Sum and Difference Identities or Double-angle identities? Explain the deciding difference.

    Hint: For Sum and Difference Identities, ask: Is the argument of the trig function a sum or difference of two angles I want to break apart?

  6. Write one sentence that would remind a classmate how to recognize Sum and Difference Identities.

    Hint: Use the mental model "Trig of a sum is a mix, never a sum of trigs." and one signal word.

Want the full set?

50 practice questions for this concept — free to try, every one with a complete worked solution showing the why, not just the answer.

Section 11

Frequently Asked Questions

How do I know when to use Sum and Difference Identities?

Use Sum and Difference Identities when the angle inside a trig function is written as a sum or difference of two angles you know. Do not start from the numbers alone; first name the structure of the situation. The fastest check is: Is the argument of the trig function a sum or difference of two angles I want to break apart? If the answer is yes and the wording matches cues like sin(A+B)\sin(A+B), exact value of 75°75° or 15°15°, A±BA\pm B inside the function, then sum and difference identities is probably the right tool.

What is Sum and Difference Identities most often confused with?

Sum and Difference Identities is often confused with Double-angle identities. Double-angle identities means The special case where both angles are equal, A=BA=B. The difference is not just vocabulary; it changes the action you take. For sum and difference identities, the key test is "Is the argument of the trig function a sum or difference of two angles I want to break apart?" For double-angle identities, the better cue is: Use when the angle is exactly twice another, like 2θ2\theta.

What is the fastest recognition cue for Sum and Difference Identities?

Look for sin(A+B)\sin(A+B), exact value of 75°75° or 15°15°, A±BA\pm B inside the function, combine two angles, but treat those words as clues, not proof. A word problem can contain a familiar keyword and still ask for a different idea. After noticing the cue, ask the recognition question: Is the argument of the trig function a sum or difference of two angles I want to break apart? That question protects you from using a memorized procedure in the wrong place.

What mistake should I avoid with Sum and Difference Identities?

Avoid this thinking: "Splitting cos(A+B)\cos(A+B) as cosA+cosB\cos A+\cos B" That mistake usually happens when the student jumps to a rule before checking the situation. The safer version is: it expands to cosAcosBsinAsinB\cos A\cos B-\sin A\sin B, a product mix. A good habit is to say the mental model out loud first: "Trig of a sum is a mix, never a sum of trigs." Then choose the calculation or representation.

How can I tell this apart from Pythagorean identities?

Pythagorean identities is the better fit when the task is about this: Relate squares of one angle's trig values; no second angle involved. Sum and Difference Identities is the better fit when the angle inside a trig function is written as a sum or difference of two angles you know. If both ideas seem possible, compare what the problem wants as the final answer. The desired output often reveals whether you should use sum and difference identities or switch to the nearby concept.

Why does Sum and Difference Identities matter?

They unlock exact values for angles outside the special set and are the launchpad for double-angle and product-to-sum work. The fatal error — assuming sin(A+B)=sinA+sinB\sin(A+B)=\sin A+\sin B — wrecks all of trig, since trig functions are not linear. The practical value is recognition: once you can spot sum and difference identities, you can choose a method before calculating. That makes later topics easier because you are not memorizing isolated tricks; you are recognizing the same structure when it appears in a new representation.

Section 12

Learning Path

Sum and Difference Identities

You are here

Before this, students should be comfortable with Pythagorean Trigonometric Identities and Trigonometric Functions. This page focuses on the recognition cue: Is the argument of the trig function a sum or difference of two angles I want to break apart? That cue is the bridge between earlier skills and later problem solving: students first learn to identify the structure, then they learn which calculation, diagram, graph, or proof move belongs to it. After this, Double-Angle Identities become easier to recognize.

Section 13

See Also